C8H10N2O2 — CID 5374061
(E)-3-(1,5-dimethylpyrazol-4-yl)prop-2-enoic acid (PubChem CID 5374061) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is (E)-3-(1,5-dimethylpyrazol-4-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(1,5-dimethylpyrazol-4-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 5374061 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | (E)-3-(1,5-dimethylpyrazol-4-yl)prop-2-enoic acid |
| SMILES | Cc1c(/C=C/C(=O)O)cnn1C |
| InChI | InChI=1S/C8H10N2O2/c1-6-7(3-4-8(11)12)5-9-10(6)2/h3-5H,1-2H3,(H,11,12)/b4-3+ |
| InChIKey | CBOKTROFJZJRKQ-ONEGZZNKSA-N |
| XLogP | 0.83 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|