C11H17N — CID 162785101
2,8-dimethylnona-2,7-dienenitrile (PubChem CID 162785101) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is 2,8-dimethylnona-2,7-dienenitrile.
| Compound Name | 2,8-dimethylnona-2,7-dienenitrile |
|---|---|
| PubChem CID | 162785101 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 2,8-dimethylnona-2,7-dienenitrile |
| SMILES | CC(C)=CCCCC=C(C)C#N |
| InChI | InChI=1S/C11H17N/c1-10(2)7-5-4-6-8-11(3)9-12/h7-8H,4-6H2,1-3H3 |
| InChIKey | BFFLFNZEHYIWRX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|