C8H19N3 — CID 142384162
ethane;(3Z)-4-hydrazinylhexa-1,3,5-trien-3-amine;molecular hydrogen (PubChem CID 142384162) has the molecular formula C8H19N3 and a molecular weight of 157.26 g/mol. Its IUPAC name is ethane;(3Z)-4-hydrazinylhexa-1,3,5-trien-3-amine;molecular hydrogen.
| Compound Name | ethane;(3Z)-4-hydrazinylhexa-1,3,5-trien-3-amine;molecular hydrogen |
|---|---|
| PubChem CID | 142384162 |
| Molecular Formula | C8H19N3 |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.16 |
| IUPAC Name | ethane;(3Z)-4-hydrazinylhexa-1,3,5-trien-3-amine;molecular hydrogen |
| SMILES | C=C/C(N)=C(\C=C)NN.CC.[H][H] |
| InChI | InChI=1S/C6H11N3.C2H6.H2/c1-3-5(7)6(4-2)9-8;1-2;/h3-4,9H,1-2,7-8H2;1-2H3;1H/b6-5-;; |
| InChIKey | OGBQMVSPWINZKO-XNOMRPDFSA-N |
| XLogP | 1.26 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|