C7H12IN3 — CID 88994635
(2Z,4E)-2-hydrazinyl-5-iodohepta-2,4,6-trien-3-amine (PubChem CID 88994635) has the molecular formula C7H12IN3 and a molecular weight of 265.10 g/mol. Its IUPAC name is (2Z,4E)-2-hydrazinyl-5-iodohepta-2,4,6-trien-3-amine.
| Compound Name | (2Z,4E)-2-hydrazinyl-5-iodohepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 88994635 |
| Molecular Formula | C7H12IN3 |
| Molecular Weight | 265.10 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | (2Z,4E)-2-hydrazinyl-5-iodohepta-2,4,6-trien-3-amine |
| SMILES | C=C/C(I)=C\C(N)=C(/C)NN |
| InChI | InChI=1S/C7H12IN3/c1-3-6(8)4-7(9)5(2)11-10/h3-4,11H,1,9-10H2,2H3/b6-4+,7-5- |
| InChIKey | SRWDSDZSFONPNY-GUBXDBFYSA-N |
| XLogP | 1.14 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.10 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|