C8H17N2O2P — CID 156802390
(1Z)-1-[dihydroxy(methylidene)-λ5-phosphanyl]-1-(methylideneamino)buta-1,3-dien-2-amine;ethane (PubChem CID 156802390) has the molecular formula C8H17N2O2P and a molecular weight of 204.21 g/mol. Its IUPAC name is (1Z)-1-[dihydroxy(methylidene)-λ5-phosphanyl]-1-(methylideneamino)buta-1,3-dien-2-amine;ethane.
| Compound Name | (1Z)-1-[dihydroxy(methylidene)-λ5-phosphanyl]-1-(methylideneamino)buta-1,3-dien-2-amine;ethane |
|---|---|
| PubChem CID | 156802390 |
| Molecular Formula | C8H17N2O2P |
| Molecular Weight | 204.21 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | (1Z)-1-[dihydroxy(methylidene)-λ5-phosphanyl]-1-(methylideneamino)buta-1,3-dien-2-amine;ethane |
| SMILES | C=C/C(N)=C(\N=C)P(=C)(O)O.CC |
| InChI | InChI=1S/C6H11N2O2P.C2H6/c1-4-5(7)6(8-2)11(3,9)10;1-2/h4,9-10H,1-3,7H2;1-2H3/b6-5-; |
| InChIKey | JYFXAGMKNQBWMQ-YSMBQZINSA-N |
| XLogP | 1.29 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.21 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|