C10H20N2S — CID 176556856
S-[(3Z,5Z)-4-amino-5-methylhepta-1,3,5-trien-3-yl]thiohydroxylamine;ethane (PubChem CID 176556856) has the molecular formula C10H20N2S and a molecular weight of 200.35 g/mol. Its IUPAC name is S-[(3Z,5Z)-4-amino-5-methylhepta-1,3,5-trien-3-yl]thiohydroxylamine;ethane.
| Compound Name | S-[(3Z,5Z)-4-amino-5-methylhepta-1,3,5-trien-3-yl]thiohydroxylamine;ethane |
|---|---|
| PubChem CID | 176556856 |
| Molecular Formula | C10H20N2S |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | S-[(3Z,5Z)-4-amino-5-methylhepta-1,3,5-trien-3-yl]thiohydroxylamine;ethane |
| SMILES | C=C/C(SN)=C(N)\C(C)=C/C.CC |
| InChI | InChI=1S/C8H14N2S.C2H6/c1-4-6(3)8(9)7(5-2)11-10;1-2/h4-5H,2,9-10H2,1,3H3;1-2H3/b6-4-,8-7-; |
| InChIKey | BYEMRRDEXBXYBI-VSZQJPAFSA-N |
| XLogP | 2.94 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|