C19H34NO5P — CID 145423658
3-acetyloxypropylphosphonic acid;methanamine;(3Z,5E,7Z)-6-methyl-5-[(Z)-prop-1-enyl]nona-1,3,5,7-tetraene (PubChem CID 145423658) has the molecular formula C19H34NO5P and a molecular weight of 387.46 g/mol. Its IUPAC name is 3-acetyloxypropylphosphonic acid;methanamine;(3Z,5E,7Z)-6-methyl-5-[(Z)-prop-1-enyl]nona-1,3,5,7-tetraene.
| Compound Name | 3-acetyloxypropylphosphonic acid;methanamine;(3Z,5E,7Z)-6-methyl-5-[(Z)-prop-1-enyl]nona-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 145423658 |
| Molecular Formula | C19H34NO5P |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 3-acetyloxypropylphosphonic acid;methanamine;(3Z,5E,7Z)-6-methyl-5-[(Z)-prop-1-enyl]nona-1,3,5,7-tetraene |
| SMILES | C=C/C=C\C(\C=C/C)=C(C)\C=C/C.CC(=O)OCCCP(=O)(O)O.CN |
| InChI | InChI=1S/C13H18.C5H11O5P.CH5N/c1-5-8-11-13(10-7-3)12(4)9-6-2;1-5(6)10-3-2-4-11(7,8)9;1-2/h5-11H,1H2,2-4H3;2-4H2,1H3,(H2,7,8,9);2H2,1H3/b9-6-,10-7-,11-8-,13-12+;; |
| InChIKey | ZQEBIJMUDSPSAF-QOQGUEPGSA-N |
| XLogP | 3.89 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|