C16H20S — CID 145084792
2,4-dimethyl-1-[(3E,5Z)-3-methylhepta-1,3,5-trien-4-yl]sulfanylbenzene (PubChem CID 145084792) has the molecular formula C16H20S and a molecular weight of 244.40 g/mol. Its IUPAC name is 2,4-dimethyl-1-[(3E,5Z)-3-methylhepta-1,3,5-trien-4-yl]sulfanylbenzene.
| Compound Name | 2,4-dimethyl-1-[(3E,5Z)-3-methylhepta-1,3,5-trien-4-yl]sulfanylbenzene |
|---|---|
| PubChem CID | 145084792 |
| Molecular Formula | C16H20S |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 2,4-dimethyl-1-[(3E,5Z)-3-methylhepta-1,3,5-trien-4-yl]sulfanylbenzene |
| SMILES | C=C/C(C)=C(\C=C/C)Sc1ccc(C)cc1C |
| InChI | InChI=1S/C16H20S/c1-6-8-15(13(4)7-2)17-16-10-9-12(3)11-14(16)5/h6-11H,2H2,1,3-5H3/b8-6-,15-13+ |
| InChIKey | OBHVIFMYWZDVBK-MZIYWGQSSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|