C15H19NS — CID 144993655
(3Z,5Z)-4-(2,4-dimethylphenyl)sulfanylhepta-1,3,5-trien-3-amine (PubChem CID 144993655) has the molecular formula C15H19NS and a molecular weight of 245.39 g/mol. Its IUPAC name is (3Z,5Z)-4-(2,4-dimethylphenyl)sulfanylhepta-1,3,5-trien-3-amine.
| Compound Name | (3Z,5Z)-4-(2,4-dimethylphenyl)sulfanylhepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 144993655 |
| Molecular Formula | C15H19NS |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | (3Z,5Z)-4-(2,4-dimethylphenyl)sulfanylhepta-1,3,5-trien-3-amine |
| SMILES | C=C/C(N)=C(\C=C/C)Sc1ccc(C)cc1C |
| InChI | InChI=1S/C15H19NS/c1-5-7-15(13(16)6-2)17-14-9-8-11(3)10-12(14)4/h5-10H,2,16H2,1,3-4H3/b7-5-,15-13- |
| InChIKey | HCRWHXDKOYOGTE-PGGAFRPESA-N |
| XLogP | 4.33 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|