C11H13ClS — CID 130670153
1-(2-chloroprop-2-enylsulfanyl)-2,4-dimethylbenzene (PubChem CID 130670153) has the molecular formula C11H13ClS and a molecular weight of 212.74 g/mol. Its IUPAC name is 1-(2-chloroprop-2-enylsulfanyl)-2,4-dimethylbenzene.
| Compound Name | 1-(2-chloroprop-2-enylsulfanyl)-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 130670153 |
| Molecular Formula | C11H13ClS |
| Molecular Weight | 212.74 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 1-(2-chloroprop-2-enylsulfanyl)-2,4-dimethylbenzene |
| SMILES | C=C(Cl)CSc1ccc(C)cc1C |
| InChI | InChI=1S/C11H13ClS/c1-8-4-5-11(9(2)6-8)13-7-10(3)12/h4-6H,3,7H2,1-2H3 |
| InChIKey | PMCYLCQPYSELKK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.74 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |