C10H15NOS — CID 117034623
2-amino-2-(2,4-dimethylphenyl)sulfanylethanol (PubChem CID 117034623) has the molecular formula C10H15NOS and a molecular weight of 197.30 g/mol. Its IUPAC name is 2-amino-2-(2,4-dimethylphenyl)sulfanylethanol.
| Compound Name | 2-amino-2-(2,4-dimethylphenyl)sulfanylethanol |
|---|---|
| PubChem CID | 117034623 |
| Molecular Formula | C10H15NOS |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 2-amino-2-(2,4-dimethylphenyl)sulfanylethanol |
| SMILES | Cc1ccc(SC(N)CO)c(C)c1 |
| InChI | InChI=1S/C10H15NOS/c1-7-3-4-9(8(2)5-7)13-10(11)6-12/h3-5,10,12H,6,11H2,1-2H3 |
| InChIKey | QYWSCOYKWHZHNP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|