C11H15NO2S — CID 117034735
3-amino-3-(2,4-dimethylphenyl)sulfanylpropanoic acid (PubChem CID 117034735) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is 3-amino-3-(2,4-dimethylphenyl)sulfanylpropanoic acid.
| Compound Name | 3-amino-3-(2,4-dimethylphenyl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 117034735 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 3-amino-3-(2,4-dimethylphenyl)sulfanylpropanoic acid |
| SMILES | Cc1ccc(SC(N)CC(=O)O)c(C)c1 |
| InChI | InChI=1S/C11H15NO2S/c1-7-3-4-9(8(2)5-7)15-10(12)6-11(13)14/h3-5,10H,6,12H2,1-2H3,(H,13,14) |
| InChIKey | SBYSZXLENQAKMW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|