C9H10S3 — CID 21422861
(2,4-dimethylphenyl)sulfanylmethanedithioic acid (PubChem CID 21422861) has the molecular formula C9H10S3 and a molecular weight of 214.38 g/mol. Its IUPAC name is (2,4-dimethylphenyl)sulfanylmethanedithioic acid.
| Compound Name | (2,4-dimethylphenyl)sulfanylmethanedithioic acid |
|---|---|
| PubChem CID | 21422861 |
| Molecular Formula | C9H10S3 |
| Molecular Weight | 214.38 g/mol |
| Exact Mass | 213.99 |
| IUPAC Name | (2,4-dimethylphenyl)sulfanylmethanedithioic acid |
| SMILES | Cc1ccc(SC(=S)S)c(C)c1 |
| InChI | InChI=1S/C9H10S3/c1-6-3-4-8(7(2)5-6)12-9(10)11/h3-5H,1-2H3,(H,10,11) |
| InChIKey | VDIQTNLBVBAEOV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|