C17H19NS2 — CID 87178961
bis(2,4-dimethylphenyl)carbamodithioic acid (PubChem CID 87178961) has the molecular formula C17H19NS2 and a molecular weight of 301.48 g/mol. Its IUPAC name is bis(2,4-dimethylphenyl)carbamodithioic acid.
| Compound Name | bis(2,4-dimethylphenyl)carbamodithioic acid |
|---|---|
| PubChem CID | 87178961 |
| Molecular Formula | C17H19NS2 |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | bis(2,4-dimethylphenyl)carbamodithioic acid |
| SMILES | Cc1ccc(N(C(=S)S)c2ccc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C17H19NS2/c1-11-5-7-15(13(3)9-11)18(17(19)20)16-8-6-12(2)10-14(16)4/h5-10H,1-4H3,(H,19,20) |
| InChIKey | JEIXPCBMWVOKJW-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|