C14H19N — CID 145026742
N-(1-cyclopropylideneethyl)-N,2,4-trimethylaniline (PubChem CID 145026742) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is N-(1-cyclopropylideneethyl)-N,2,4-trimethylaniline.
| Compound Name | N-(1-cyclopropylideneethyl)-N,2,4-trimethylaniline |
|---|---|
| PubChem CID | 145026742 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | N-(1-cyclopropylideneethyl)-N,2,4-trimethylaniline |
| SMILES | CC(=C1CC1)N(C)c1ccc(C)cc1C |
| InChI | InChI=1S/C14H19N/c1-10-5-8-14(11(2)9-10)15(4)12(3)13-6-7-13/h5,8-9H,6-7H2,1-4H3 |
| InChIKey | JVBMUIXOGLAHFK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |