C12H15Br — CID 91077238
2-bromo-6-methyl-5-methylidenedeca-1,3,6,8-tetraene (PubChem CID 91077238) has the molecular formula C12H15Br and a molecular weight of 239.16 g/mol. Its IUPAC name is 2-bromo-6-methyl-5-methylidenedeca-1,3,6,8-tetraene.
| Compound Name | 2-bromo-6-methyl-5-methylidenedeca-1,3,6,8-tetraene |
|---|---|
| PubChem CID | 91077238 |
| Molecular Formula | C12H15Br |
| Molecular Weight | 239.16 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 2-bromo-6-methyl-5-methylidenedeca-1,3,6,8-tetraene |
| SMILES | C=C(Br)C=CC(=C)C(C)=CC=CC |
| InChI | InChI=1S/C12H15Br/c1-5-6-7-10(2)11(3)8-9-12(4)13/h5-9H,3-4H2,1-2H3 |
| InChIKey | LPQBBAXJYJAAPK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.16 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|