C17H24 — CID 173202075
2,4,13-trimethyltetradeca-2,4,6,8,10,12-hexaene (PubChem CID 173202075) has the molecular formula C17H24 and a molecular weight of 228.38 g/mol. Its IUPAC name is 2,4,13-trimethyltetradeca-2,4,6,8,10,12-hexaene.
| Compound Name | 2,4,13-trimethyltetradeca-2,4,6,8,10,12-hexaene |
|---|---|
| PubChem CID | 173202075 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | 2,4,13-trimethyltetradeca-2,4,6,8,10,12-hexaene |
| SMILES | CC(C)=CC=CC=CC=CC=C(C)C=C(C)C |
| InChI | InChI=1S/C17H24/c1-15(2)12-10-8-6-7-9-11-13-17(5)14-16(3)4/h6-14H,1-5H3 |
| InChIKey | VSPPBPLDNQLGKO-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|