C19H26 — CID 173202044
2,4,15-trimethylhexadeca-2,4,6,8,10,12,14-heptaene (PubChem CID 173202044) has the molecular formula C19H26 and a molecular weight of 254.42 g/mol. Its IUPAC name is 2,4,15-trimethylhexadeca-2,4,6,8,10,12,14-heptaene.
| Compound Name | 2,4,15-trimethylhexadeca-2,4,6,8,10,12,14-heptaene |
|---|---|
| PubChem CID | 173202044 |
| Molecular Formula | C19H26 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | 2,4,15-trimethylhexadeca-2,4,6,8,10,12,14-heptaene |
| SMILES | CC(C)=CC=CC=CC=CC=CC=C(C)C=C(C)C |
| InChI | InChI=1S/C19H26/c1-17(2)14-12-10-8-6-7-9-11-13-15-19(5)16-18(3)4/h6-16H,1-5H3 |
| InChIKey | NJPTZGXWOQVGTR-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|