C16H26 — CID 10420952
(4E,9E)-2,4,12-trimethyltrideca-2,4,9,11-tetraene (PubChem CID 10420952) has the molecular formula C16H26 and a molecular weight of 218.38 g/mol. Its IUPAC name is (4E,9E)-2,4,12-trimethyltrideca-2,4,9,11-tetraene.
| Compound Name | (4E,9E)-2,4,12-trimethyltrideca-2,4,9,11-tetraene |
|---|---|
| PubChem CID | 10420952 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | (4E,9E)-2,4,12-trimethyltrideca-2,4,9,11-tetraene |
| SMILES | CC(C)=C/C=C/CCC/C=C(\C)C=C(C)C |
| InChI | InChI=1S/C16H26/c1-14(2)11-9-7-6-8-10-12-16(5)13-15(3)4/h7,9,11-13H,6,8,10H2,1-5H3/b9-7+,16-12+ |
| InChIKey | NLUQEGKHULZDIJ-PBCDPYBESA-N |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|