C9H15Br — CID 122235653
(4E)-7-bromo-2,4-dimethylhepta-2,4-diene (PubChem CID 122235653) has the molecular formula C9H15Br and a molecular weight of 203.12 g/mol. Its IUPAC name is (4E)-7-bromo-2,4-dimethylhepta-2,4-diene.
| Compound Name | (4E)-7-bromo-2,4-dimethylhepta-2,4-diene |
|---|---|
| PubChem CID | 122235653 |
| Molecular Formula | C9H15Br |
| Molecular Weight | 203.12 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | (4E)-7-bromo-2,4-dimethylhepta-2,4-diene |
| SMILES | CC(C)=C/C(C)=C/CCBr |
| InChI | InChI=1S/C9H15Br/c1-8(2)7-9(3)5-4-6-10/h5,7H,4,6H2,1-3H3/b9-5+ |
| InChIKey | OMBPZEDITHAOJO-WEVVVXLNSA-N |
| XLogP | 3.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.12 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|