C14H25BrO — CID 11822357
(5E,9E)-12-bromo-5,9-dimethyldodeca-5,9-dien-1-ol (PubChem CID 11822357) has the molecular formula C14H25BrO and a molecular weight of 289.26 g/mol. Its IUPAC name is (5E,9E)-12-bromo-5,9-dimethyldodeca-5,9-dien-1-ol.
| Compound Name | (5E,9E)-12-bromo-5,9-dimethyldodeca-5,9-dien-1-ol |
|---|---|
| PubChem CID | 11822357 |
| Molecular Formula | C14H25BrO |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | (5E,9E)-12-bromo-5,9-dimethyldodeca-5,9-dien-1-ol |
| SMILES | C/C(=C\CCBr)CC/C=C(\C)CCCCO |
| InChI | InChI=1S/C14H25BrO/c1-13(7-3-4-12-16)8-5-9-14(2)10-6-11-15/h8,10,16H,3-7,9,11-12H2,1-2H3/b13-8+,14-10+ |
| InChIKey | CDVUXZUPOVQQMT-WCKMZMOMSA-N |
| XLogP | 4.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|