C14H27AlO — CID 134895349
(5E,9E)-10-dimethylalumanyl-5,9-dimethyldeca-5,9-dien-1-ol (PubChem CID 134895349) has the molecular formula C14H27AlO and a molecular weight of 238.35 g/mol. Its IUPAC name is (5E,9E)-10-dimethylalumanyl-5,9-dimethyldeca-5,9-dien-1-ol.
| Compound Name | (5E,9E)-10-dimethylalumanyl-5,9-dimethyldeca-5,9-dien-1-ol |
|---|---|
| PubChem CID | 134895349 |
| Molecular Formula | C14H27AlO |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (5E,9E)-10-dimethylalumanyl-5,9-dimethyldeca-5,9-dien-1-ol |
| SMILES | C/C(=C\[Al](C)C)CC/C=C(\C)CCCCO |
| InChI | InChI=1S/C12H21O.2CH3.Al/c1-11(2)7-6-9-12(3)8-4-5-10-13;;;/h1,9,13H,4-8,10H2,2-3H3;2*1H3;/b11-1?,12-9+;;; |
| InChIKey | CZJOQFCEKYJLMK-ZYRDJOGBSA-N |
| XLogP | 4.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|