C18H27N — CID 170141500
(3E,5Z)-3-ethenyl-N-[(E)-4-methylhept-3-en-3-yl]-2-methylidenehepta-3,5-dien-1-imine (PubChem CID 170141500) has the molecular formula C18H27N and a molecular weight of 257.42 g/mol. Its IUPAC name is (3E,5Z)-3-ethenyl-N-[(E)-4-methylhept-3-en-3-yl]-2-methylidenehepta-3,5-dien-1-imine.
| Compound Name | (3E,5Z)-3-ethenyl-N-[(E)-4-methylhept-3-en-3-yl]-2-methylidenehepta-3,5-dien-1-imine |
|---|---|
| PubChem CID | 170141500 |
| Molecular Formula | C18H27N |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | (3E,5Z)-3-ethenyl-N-[(E)-4-methylhept-3-en-3-yl]-2-methylidenehepta-3,5-dien-1-imine |
| SMILES | C=C/C(=C\C=C/C)C(=C)/C=N/C(CC)=C(\C)CCC |
| InChI | InChI=1S/C18H27N/c1-7-11-13-17(9-3)16(6)14-19-18(10-4)15(5)12-8-2/h7,9,11,13-14H,3,6,8,10,12H2,1-2,4-5H3/b11-7-,17-13+,18-15+,19-14+ |
| InChIKey | JMHWHFVUQLLKQG-TVOSDRFVSA-N |
| XLogP | 5.79 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|