C15H17N3 — CID 174316309
N'-[2-[(Z)-prop-1-enyl]penta-2,4-dienimidoyl]benzenecarboximidamide (PubChem CID 174316309) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is N'-[2-[(Z)-prop-1-enyl]penta-2,4-dienimidoyl]benzenecarboximidamide.
| Compound Name | N'-[2-[(Z)-prop-1-enyl]penta-2,4-dienimidoyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 174316309 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | N'-[2-[(Z)-prop-1-enyl]penta-2,4-dienimidoyl]benzenecarboximidamide |
| SMILES | [H]/N=C(/N=C(\N)c1ccccc1)C(=CC=C)/C=C\C |
| InChI | InChI=1S/C15H17N3/c1-3-8-12(9-4-2)14(16)18-15(17)13-10-6-5-7-11-13/h3-11H,1H2,2H3,(H3,16,17,18)/b9-4-,12-8? |
| InChIKey | FIZWDRORTMXRMV-RGQSMMICSA-N |
| XLogP | 3.06 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|