C22H29NO — CID 144714215
(2S)-5,5-dimethyl-2-[[(2E)-1-phenyl-2-[(Z)-prop-1-enyl]penta-2,4-dienylidene]amino]hexan-3-one (PubChem CID 144714215) has the molecular formula C22H29NO and a molecular weight of 323.48 g/mol. Its IUPAC name is (2S)-5,5-dimethyl-2-[[(2E)-1-phenyl-2-[(Z)-prop-1-enyl]penta-2,4-dienylidene]amino]hexan-3-one.
| Compound Name | (2S)-5,5-dimethyl-2-[[(2E)-1-phenyl-2-[(Z)-prop-1-enyl]penta-2,4-dienylidene]amino]hexan-3-one |
|---|---|
| PubChem CID | 144714215 |
| Molecular Formula | C22H29NO |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | (2S)-5,5-dimethyl-2-[[(2E)-1-phenyl-2-[(Z)-prop-1-enyl]penta-2,4-dienylidene]amino]hexan-3-one |
| SMILES | C=C/C=C(\C=C/C)C(=N/[C@@H](C)C(=O)CC(C)(C)C)/c1ccccc1 |
| InChI | InChI=1S/C22H29NO/c1-7-12-18(13-8-2)21(19-14-10-9-11-15-19)23-17(3)20(24)16-22(4,5)6/h7-15,17H,1,16H2,2-6H3/b13-8-,18-12+,23-21-/t17-/m0/s1 |
| InChIKey | HJPSZVVFHZLKTJ-SJBSULTFSA-N |
| XLogP | 5.56 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|