C26H27N — CID 162363251
(3E)-N-[1-(3-phenylphenyl)pent-2-ynyl]-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-imine (PubChem CID 162363251) has the molecular formula C26H27N and a molecular weight of 353.51 g/mol. Its IUPAC name is (3E)-N-[1-(3-phenylphenyl)pent-2-ynyl]-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-imine.
| Compound Name | (3E)-N-[1-(3-phenylphenyl)pent-2-ynyl]-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-imine |
|---|---|
| PubChem CID | 162363251 |
| Molecular Formula | C26H27N |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | (3E)-N-[1-(3-phenylphenyl)pent-2-ynyl]-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-imine |
| SMILES | C=C/C=C(\C=C/C)C(/C)=N/C(C#CCC)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C26H27N/c1-5-8-19-26(27-21(4)22(13-6-2)14-7-3)25-18-12-17-24(20-25)23-15-10-9-11-16-23/h6-7,9-18,20,26H,2,5H2,1,3-4H3/b14-7-,22-13+,27-21+ |
| InChIKey | QWUSUZCIJIWPJF-VUMDFQNFSA-N |
| XLogP | 6.96 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|