C18H19N — CID 144640465
(2Z)-3-methyl-1-(3-phenylphenyl)penta-2,4-dien-1-amine (PubChem CID 144640465) has the molecular formula C18H19N and a molecular weight of 249.36 g/mol. Its IUPAC name is (2Z)-3-methyl-1-(3-phenylphenyl)penta-2,4-dien-1-amine.
| Compound Name | (2Z)-3-methyl-1-(3-phenylphenyl)penta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 144640465 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | (2Z)-3-methyl-1-(3-phenylphenyl)penta-2,4-dien-1-amine |
| SMILES | C=C/C(C)=C\C(N)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C18H19N/c1-3-14(2)12-18(19)17-11-7-10-16(13-17)15-8-5-4-6-9-15/h3-13,18H,1,19H2,2H3/b14-12- |
| InChIKey | LCPVJXJRVPOKFH-OWBHPGMISA-N |
| XLogP | 4.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|