C21H20N2 — CID 126700302
(Z)-3-[3-(4-phenylphenyl)phenyl]prop-1-ene-1,3-diamine (PubChem CID 126700302) has the molecular formula C21H20N2 and a molecular weight of 300.41 g/mol. Its IUPAC name is (Z)-3-[3-(4-phenylphenyl)phenyl]prop-1-ene-1,3-diamine.
| Compound Name | (Z)-3-[3-(4-phenylphenyl)phenyl]prop-1-ene-1,3-diamine |
|---|---|
| PubChem CID | 126700302 |
| Molecular Formula | C21H20N2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | (Z)-3-[3-(4-phenylphenyl)phenyl]prop-1-ene-1,3-diamine |
| SMILES | N/C=C\C(N)c1cccc(-c2ccc(-c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C21H20N2/c22-14-13-21(23)20-8-4-7-19(15-20)18-11-9-17(10-12-18)16-5-2-1-3-6-16/h1-15,21H,22-23H2/b14-13- |
| InChIKey | LWVJAYCZSCZTKN-YPKPFQOOSA-N |
| XLogP | 4.49 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |