About 1-amino-2-phenylethene-1,2-diol;hydron
1-amino-2-phenylethene-1,2-diol;hydron (PubChem CID 131854255) has the molecular formula C8H10NO2+
and a molecular weight of 152.17 g/mol. Its IUPAC name is 1-amino-2-phenylethene-1,2-diol;hydron.
Molecular Properties
| Compound Name | 1-amino-2-phenylethene-1,2-diol;hydron |
| PubChem CID | 131854255 |
| Molecular Formula | C8H10NO2+ |
| Molecular Weight | 152.17 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | 1-amino-2-phenylethene-1,2-diol;hydron |
| SMILES | NC(O)=C(O)c1ccccc1.[H+] |
| InChI | InChI=1S/C8H9NO2/c9-8(11)7(10)6-4-2-1-3-5-6/h1-5,10-11H,9H2/p+1 |
| InChIKey | ABIFEULUKBOKQJ-UHFFFAOYSA-O |
| XLogP | 1.50 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.17 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-2-phenylethene-1,2-diol;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-2-phenylethene-1,2-diol;hydron?
The IUPAC name of 1-amino-2-phenylethene-1,2-diol;hydron (CID 131854255) is 1-amino-2-phenylethene-1,2-diol;hydron.
What is the SMILES notation for 1-amino-2-phenylethene-1,2-diol;hydron?
The canonical SMILES for 1-amino-2-phenylethene-1,2-diol;hydron is NC(O)=C(O)c1ccccc1.[H+].
What is the InChIKey of 1-amino-2-phenylethene-1,2-diol;hydron?
The InChIKey is ABIFEULUKBOKQJ-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H9NO2/c9-8(11)7(10)6-4-2-1-3-5-6/h1-5,10-11H,9H2/p+1.
What are the key properties of 1-amino-2-phenylethene-1,2-diol;hydron?
1-amino-2-phenylethene-1,2-diol;hydron has a molecular weight of 152.17 g/mol, XLogP of 1.50, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-2-phenylethene-1,2-diol;hydron is sourced from PubChem (CID 131854255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).