C15H12S2 — CID 23346868
1,3-diphenylpropane-1,3-dithione (PubChem CID 23346868) has the molecular formula C15H12S2 and a molecular weight of 256.40 g/mol. Its IUPAC name is 1,3-diphenylpropane-1,3-dithione.
| Compound Name | 1,3-diphenylpropane-1,3-dithione |
|---|---|
| PubChem CID | 23346868 |
| Molecular Formula | C15H12S2 |
| Molecular Weight | 256.40 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 1,3-diphenylpropane-1,3-dithione |
| SMILES | S=C(CC(=S)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H12S2/c16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13/h1-10H,11H2 |
| InChIKey | HXCGIBAJIATXKC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.40 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|