C14H12Se2 — CID 175146391
2,2-diphenylethene-1,1-diselenol (PubChem CID 175146391) has the molecular formula C14H12Se2 and a molecular weight of 338.17 g/mol. Its IUPAC name is 2,2-diphenylethene-1,1-diselenol.
| Compound Name | 2,2-diphenylethene-1,1-diselenol |
|---|---|
| PubChem CID | 175146391 |
| Molecular Formula | C14H12Se2 |
| Molecular Weight | 338.17 g/mol |
| Exact Mass | 339.93 |
| IUPAC Name | 2,2-diphenylethene-1,1-diselenol |
| SMILES | [SeH]C([SeH])=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H12Se2/c15-14(16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,15-16H |
| InChIKey | RXPBNDJPUXUVFD-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.17 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|