About (1-(131I)iodo-2,2-diphenylethenyl)benzene
(1-(131I)iodo-2,2-diphenylethenyl)benzene (PubChem CID 134933335) has the molecular formula C20H15I
and a molecular weight of 386.25 g/mol. Its IUPAC name is (1-(131I)iodo-2,2-diphenylethenyl)benzene.
Molecular Properties
| Compound Name | (1-(131I)iodo-2,2-diphenylethenyl)benzene |
| PubChem CID | 134933335 |
| Molecular Formula | C20H15I |
| Molecular Weight | 386.25 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | (1-(131I)iodo-2,2-diphenylethenyl)benzene |
| SMILES | [131I]C(=C(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H15I/c21-20(18-14-8-3-9-15-18)19(16-10-4-1-5-11-16)17-12-6-2-7-13-17/h1-15H/i21+4 |
| InChIKey | DVJCEGLTPUEWNX-TWYGLIRSSA-N |
| XLogP | 6.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.25 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (1-(131I)iodo-2,2-diphenylethenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-(131I)iodo-2,2-diphenylethenyl)benzene?
The IUPAC name of (1-(131I)iodo-2,2-diphenylethenyl)benzene (CID 134933335) is (1-(131I)iodo-2,2-diphenylethenyl)benzene.
What is the SMILES notation for (1-(131I)iodo-2,2-diphenylethenyl)benzene?
The canonical SMILES for (1-(131I)iodo-2,2-diphenylethenyl)benzene is [131I]C(=C(c1ccccc1)c1ccccc1)c1ccccc1.
What is the InChIKey of (1-(131I)iodo-2,2-diphenylethenyl)benzene?
The InChIKey is DVJCEGLTPUEWNX-TWYGLIRSSA-N. The full InChI is InChI=1S/C20H15I/c21-20(18-14-8-3-9-15-18)19(16-10-4-1-5-11-16)17-12-6-2-7-13-17/h1-15H/i21+4.
What are the key properties of (1-(131I)iodo-2,2-diphenylethenyl)benzene?
(1-(131I)iodo-2,2-diphenylethenyl)benzene has a molecular weight of 386.25 g/mol, XLogP of 6.04, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1-(131I)iodo-2,2-diphenylethenyl)benzene is sourced from PubChem (CID 134933335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).