C16H16FN — CID 23105494
1-fluoro-N,N-dimethyl-2,2-diphenylethenamine (PubChem CID 23105494) has the molecular formula C16H16FN and a molecular weight of 241.31 g/mol. Its IUPAC name is 1-fluoro-N,N-dimethyl-2,2-diphenylethenamine.
| Compound Name | 1-fluoro-N,N-dimethyl-2,2-diphenylethenamine |
|---|---|
| PubChem CID | 23105494 |
| Molecular Formula | C16H16FN |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 1-fluoro-N,N-dimethyl-2,2-diphenylethenamine |
| SMILES | CN(C)C(F)=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H16FN/c1-18(2)16(17)15(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12H,1-2H3 |
| InChIKey | RUXAKCRPVHQASA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|