About lithium 1-(dimethylamino)-2,2-diphenylethenolate
lithium 1-(dimethylamino)-2,2-diphenylethenolate (PubChem CID 101054680) has the molecular formula C16H16LiNO
and a molecular weight of 245.25 g/mol. Its IUPAC name is lithium 1-(dimethylamino)-2,2-diphenylethenolate.
Molecular Properties
| Compound Name | lithium 1-(dimethylamino)-2,2-diphenylethenolate |
| PubChem CID | 101054680 |
| Molecular Formula | C16H16LiNO |
| Molecular Weight | 245.25 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | lithium 1-(dimethylamino)-2,2-diphenylethenolate |
| SMILES | CN(C)C([O-])=C(c1ccccc1)c1ccccc1.[Li+] |
| InChI | InChI=1S/C16H17NO.Li/c1-17(2)16(18)15(13-9-5-3-6-10-13)14-11-7-4-8-12-14;/h3-12,18H,1-2H3;/q;+1/p-1 |
| InChIKey | CUNXGELOOMRXJO-UHFFFAOYSA-M |
| XLogP | -0.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.25 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze lithium 1-(dimethylamino)-2,2-diphenylethenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 1-(dimethylamino)-2,2-diphenylethenolate?
The IUPAC name of lithium 1-(dimethylamino)-2,2-diphenylethenolate (CID 101054680) is lithium 1-(dimethylamino)-2,2-diphenylethenolate.
What is the SMILES notation for lithium 1-(dimethylamino)-2,2-diphenylethenolate?
The canonical SMILES for lithium 1-(dimethylamino)-2,2-diphenylethenolate is CN(C)C([O-])=C(c1ccccc1)c1ccccc1.[Li+].
What is the InChIKey of lithium 1-(dimethylamino)-2,2-diphenylethenolate?
The InChIKey is CUNXGELOOMRXJO-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H17NO.Li/c1-17(2)16(18)15(13-9-5-3-6-10-13)14-11-7-4-8-12-14;/h3-12,18H,1-2H3;/q;+1/p-1.
What are the key properties of lithium 1-(dimethylamino)-2,2-diphenylethenolate?
lithium 1-(dimethylamino)-2,2-diphenylethenolate has a molecular weight of 245.25 g/mol, XLogP of -0.67, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 1-(dimethylamino)-2,2-diphenylethenolate is sourced from PubChem (CID 101054680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).