C16H19NSi — CID 173065135
N,N-dimethyl-1,2-diphenyl-2-silylethenamine (PubChem CID 173065135) has the molecular formula C16H19NSi and a molecular weight of 253.42 g/mol. Its IUPAC name is N,N-dimethyl-1,2-diphenyl-2-silylethenamine.
| Compound Name | N,N-dimethyl-1,2-diphenyl-2-silylethenamine |
|---|---|
| PubChem CID | 173065135 |
| Molecular Formula | C16H19NSi |
| Molecular Weight | 253.42 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | N,N-dimethyl-1,2-diphenyl-2-silylethenamine |
| SMILES | CN(C)C(=C([SiH3])c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H19NSi/c1-17(2)15(13-9-5-3-6-10-13)16(18)14-11-7-4-8-12-14/h3-12H,1-2,18H3 |
| InChIKey | ILSQHTUJNLVRPK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|