C10H12N2O4S — CID 6393769
(E)-2-(benzenesulfonyl)-N,N-dimethyl-2-nitroethenamine (PubChem CID 6393769) has the molecular formula C10H12N2O4S and a molecular weight of 256.28 g/mol. Its IUPAC name is (E)-2-(benzenesulfonyl)-N,N-dimethyl-2-nitroethenamine.
| Compound Name | (E)-2-(benzenesulfonyl)-N,N-dimethyl-2-nitroethenamine |
|---|---|
| PubChem CID | 6393769 |
| Molecular Formula | C10H12N2O4S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | (E)-2-(benzenesulfonyl)-N,N-dimethyl-2-nitroethenamine |
| SMILES | CN(C)/C=C(\[N+](=O)[O-])S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C10H12N2O4S/c1-11(2)8-10(12(13)14)17(15,16)9-6-4-3-5-7-9/h3-8H,1-2H3/b10-8+ |
| InChIKey | OAKJEQMGFHUZJY-CSKARUKUSA-N |
| XLogP | 1.10 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|