C12H14N2O4S — CID 107434130
2-[(2-amino-2-oxoethyl)-[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]amino]acetic acid (PubChem CID 107434130) has the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]amino]acetic acid.
| Compound Name | 2-[(2-amino-2-oxoethyl)-[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]amino]acetic acid |
|---|---|
| PubChem CID | 107434130 |
| Molecular Formula | C12H14N2O4S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]amino]acetic acid |
| SMILES | Cc1ccc(/C=C/C(=O)N(CC(N)=O)CC(=O)O)s1 |
| InChI | InChI=1S/C12H14N2O4S/c1-8-2-3-9(19-8)4-5-11(16)14(6-10(13)15)7-12(17)18/h2-5H,6-7H2,1H3,(H2,13,15)(H,17,18)/b5-4+ |
| InChIKey | FMTRIXPCEOHAEI-SNAWJCMRSA-N |
| XLogP | 0.47 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|