C20H19Cl2FN2O2 — CID 16563281
(E)-3-(2-chloro-6-fluorophenyl)-N-[2-[(4-chlorophenyl)methylamino]-2-oxoethyl]-N-ethylprop-2-enamide (PubChem CID 16563281) has the molecular formula C20H19Cl2FN2O2 and a molecular weight of 409.29 g/mol. Its IUPAC name is (E)-3-(2-chloro-6-fluorophenyl)-N-[2-[(4-chlorophenyl)methylamino]-2-oxoethyl]-N-ethylprop-2-enamide.
| Compound Name | (E)-3-(2-chloro-6-fluorophenyl)-N-[2-[(4-chlorophenyl)methylamino]-2-oxoethyl]-N-ethylprop-2-enamide |
|---|---|
| PubChem CID | 16563281 |
| Molecular Formula | C20H19Cl2FN2O2 |
| Molecular Weight | 409.29 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | (E)-3-(2-chloro-6-fluorophenyl)-N-[2-[(4-chlorophenyl)methylamino]-2-oxoethyl]-N-ethylprop-2-enamide |
| SMILES | CCN(CC(=O)NCc1ccc(Cl)cc1)C(=O)/C=C/c1c(F)cccc1Cl |
| InChI | InChI=1S/C20H19Cl2FN2O2/c1-2-25(13-19(26)24-12-14-6-8-15(21)9-7-14)20(27)11-10-16-17(22)4-3-5-18(16)23/h3-11H,2,12-13H2,1H3,(H,24,26)/b11-10+ |
| InChIKey | CRZPTQFCELRRDH-ZHACJKMWSA-N |
| XLogP | 4.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.29 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|