C18H18BrFN2O2S — CID 26266116
(E)-3-(5-bromothiophen-2-yl)-N-ethyl-N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]prop-2-enamide (PubChem CID 26266116) has the molecular formula C18H18BrFN2O2S and a molecular weight of 425.32 g/mol. Its IUPAC name is (E)-3-(5-bromothiophen-2-yl)-N-ethyl-N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]prop-2-enamide.
| Compound Name | (E)-3-(5-bromothiophen-2-yl)-N-ethyl-N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 26266116 |
| Molecular Formula | C18H18BrFN2O2S |
| Molecular Weight | 425.32 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | (E)-3-(5-bromothiophen-2-yl)-N-ethyl-N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]prop-2-enamide |
| SMILES | CCN(CC(=O)NCc1ccc(F)cc1)C(=O)/C=C/c1ccc(Br)s1 |
| InChI | InChI=1S/C18H18BrFN2O2S/c1-2-22(18(24)10-8-15-7-9-16(19)25-15)12-17(23)21-11-13-3-5-14(20)6-4-13/h3-10H,2,11-12H2,1H3,(H,21,23)/b10-8+ |
| InChIKey | GXGMAFCJTHPKDR-CSKARUKUSA-N |
| XLogP | 3.83 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.32 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|