C28H25FN2O — CID 6077373
(E)-N-benzyl-N-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-3-phenylprop-2-enamide (PubChem CID 6077373) has the molecular formula C28H25FN2O and a molecular weight of 424.52 g/mol. Its IUPAC name is (E)-N-benzyl-N-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-benzyl-N-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 6077373 |
| Molecular Formula | C28H25FN2O |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | (E)-N-benzyl-N-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)N(Cc1ccccc1)Cc1cccn1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C28H25FN2O/c29-26-16-13-25(14-17-26)20-30-19-7-12-27(30)22-31(21-24-10-5-2-6-11-24)28(32)18-15-23-8-3-1-4-9-23/h1-19H,20-22H2/b18-15+ |
| InChIKey | LATQIEQVUYTZEF-OBGWFSINSA-N |
| XLogP | 5.92 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|