C25H26FN3O4 — CID 6091119
(E)-N-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-N-(3-methoxypropyl)-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 6091119) has the molecular formula C25H26FN3O4 and a molecular weight of 451.50 g/mol. Its IUPAC name is (E)-N-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-N-(3-methoxypropyl)-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-N-(3-methoxypropyl)-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6091119 |
| Molecular Formula | C25H26FN3O4 |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | (E)-N-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]-N-(3-methoxypropyl)-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | COCCCN(Cc1cccn1Cc1ccc(F)cc1)C(=O)/C=C/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H26FN3O4/c1-33-17-3-16-28(25(30)14-9-20-7-12-23(13-8-20)29(31)32)19-24-4-2-15-27(24)18-21-5-10-22(26)11-6-21/h2,4-15H,3,16-19H2,1H3/b14-9+ |
| InChIKey | HPFWUVLAVVNZJT-NTEUORMPSA-N |
| XLogP | 4.66 |
| TPSA | 77.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|