C27H28BrN3O3 — CID 6106682
(E)-N-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexyl-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 6106682) has the molecular formula C27H28BrN3O3 and a molecular weight of 522.44 g/mol. Its IUPAC name is (E)-N-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexyl-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexyl-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6106682 |
| Molecular Formula | C27H28BrN3O3 |
| Molecular Weight | 522.44 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | (E)-N-[[1-[(4-bromophenyl)methyl]pyrrol-2-yl]methyl]-N-cyclohexyl-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)N(Cc1cccn1Cc1ccc(Br)cc1)C1CCCCC1 |
| InChI | InChI=1S/C27H28BrN3O3/c28-23-13-8-22(9-14-23)19-29-18-4-7-26(29)20-30(24-5-2-1-3-6-24)27(32)17-12-21-10-15-25(16-11-21)31(33)34/h4,7-18,24H,1-3,5-6,19-20H2/b17-12+ |
| InChIKey | YRDMPBGLPRTIHG-SFQUDFHCSA-N |
| XLogP | 6.58 |
| TPSA | 68.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.44 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|