C30H37N3O2 — CID 42776782
(E)-N-[2-[(1-benzylpyrrol-2-yl)methyl-propan-2-ylamino]-2-oxoethyl]-N-butyl-3-phenylprop-2-enamide (PubChem CID 42776782) has the molecular formula C30H37N3O2 and a molecular weight of 471.65 g/mol. Its IUPAC name is (E)-N-[2-[(1-benzylpyrrol-2-yl)methyl-propan-2-ylamino]-2-oxoethyl]-N-butyl-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[2-[(1-benzylpyrrol-2-yl)methyl-propan-2-ylamino]-2-oxoethyl]-N-butyl-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 42776782 |
| Molecular Formula | C30H37N3O2 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.29 |
| IUPAC Name | (E)-N-[2-[(1-benzylpyrrol-2-yl)methyl-propan-2-ylamino]-2-oxoethyl]-N-butyl-3-phenylprop-2-enamide |
| SMILES | CCCCN(CC(=O)N(Cc1cccn1Cc1ccccc1)C(C)C)C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C30H37N3O2/c1-4-5-20-32(29(34)19-18-26-13-8-6-9-14-26)24-30(35)33(25(2)3)23-28-17-12-21-31(28)22-27-15-10-7-11-16-27/h6-19,21,25H,4-5,20,22-24H2,1-3H3/b19-18+ |
| InChIKey | YDZUVJQVMMDKMH-VHEBQXMUSA-N |
| XLogP | 5.62 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|