C22H32N2O — CID 42763070
N-[(1-benzylpyrrol-2-yl)methyl]-N-butyl-3,3-dimethylbutanamide (PubChem CID 42763070) has the molecular formula C22H32N2O and a molecular weight of 340.51 g/mol. Its IUPAC name is N-[(1-benzylpyrrol-2-yl)methyl]-N-butyl-3,3-dimethylbutanamide.
| Compound Name | N-[(1-benzylpyrrol-2-yl)methyl]-N-butyl-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 42763070 |
| Molecular Formula | C22H32N2O |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | N-[(1-benzylpyrrol-2-yl)methyl]-N-butyl-3,3-dimethylbutanamide |
| SMILES | CCCCN(Cc1cccn1Cc1ccccc1)C(=O)CC(C)(C)C |
| InChI | InChI=1S/C22H32N2O/c1-5-6-14-24(21(25)16-22(2,3)4)18-20-13-10-15-23(20)17-19-11-8-7-9-12-19/h7-13,15H,5-6,14,16-18H2,1-4H3 |
| InChIKey | FQQHTMUKEKWORD-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |