C21H30N2O — CID 3651106
N-[(1-benzylpyrrol-2-yl)methyl]-N-butyl-2,2-dimethylpropanamide (PubChem CID 3651106) has the molecular formula C21H30N2O and a molecular weight of 326.48 g/mol. Its IUPAC name is N-[(1-benzylpyrrol-2-yl)methyl]-N-butyl-2,2-dimethylpropanamide.
| Compound Name | N-[(1-benzylpyrrol-2-yl)methyl]-N-butyl-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 3651106 |
| Molecular Formula | C21H30N2O |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | N-[(1-benzylpyrrol-2-yl)methyl]-N-butyl-2,2-dimethylpropanamide |
| SMILES | CCCCN(Cc1cccn1Cc1ccccc1)C(=O)C(C)(C)C |
| InChI | InChI=1S/C21H30N2O/c1-5-6-14-23(20(24)21(2,3)4)17-19-13-10-15-22(19)16-18-11-8-7-9-12-18/h7-13,15H,5-6,14,16-17H2,1-4H3 |
| InChIKey | SWHGTNGQUXRRPG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |