C23H31FN2O — CID 7356708
(2S)-2-ethyl-N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-N-prop-2-enylhexanamide (PubChem CID 7356708) has the molecular formula C23H31FN2O and a molecular weight of 370.51 g/mol. Its IUPAC name is (2S)-2-ethyl-N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-N-prop-2-enylhexanamide.
| Compound Name | (2S)-2-ethyl-N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-N-prop-2-enylhexanamide |
|---|---|
| PubChem CID | 7356708 |
| Molecular Formula | C23H31FN2O |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | (2S)-2-ethyl-N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-N-prop-2-enylhexanamide |
| SMILES | C=CCN(Cc1cccn1Cc1cccc(F)c1)C(=O)[C@@H](CC)CCCC |
| InChI | InChI=1S/C23H31FN2O/c1-4-7-11-20(6-3)23(27)26(14-5-2)18-22-13-9-15-25(22)17-19-10-8-12-21(24)16-19/h5,8-10,12-13,15-16,20H,2,4,6-7,11,14,17-18H2,1,3H3/t20-/m0/s1 |
| InChIKey | DDPOLAPSSQDNKC-FQEVSTJZSA-N |
| XLogP | 5.41 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|