C25H38N2O — CID 42762987
N-butyl-2-ethyl-N-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]hexanamide (PubChem CID 42762987) has the molecular formula C25H38N2O and a molecular weight of 382.59 g/mol. Its IUPAC name is N-butyl-2-ethyl-N-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]hexanamide.
| Compound Name | N-butyl-2-ethyl-N-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]hexanamide |
|---|---|
| PubChem CID | 42762987 |
| Molecular Formula | C25H38N2O |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.30 |
| IUPAC Name | N-butyl-2-ethyl-N-[[1-[(3-methylphenyl)methyl]pyrrol-2-yl]methyl]hexanamide |
| SMILES | CCCCC(CC)C(=O)N(CCCC)Cc1cccn1Cc1cccc(C)c1 |
| InChI | InChI=1S/C25H38N2O/c1-5-8-14-23(7-3)25(28)27(16-9-6-2)20-24-15-11-17-26(24)19-22-13-10-12-21(4)18-22/h10-13,15,17-18,23H,5-9,14,16,19-20H2,1-4H3 |
| InChIKey | ZTPLOGUXEBCQAE-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |