C26H31FN2O — CID 7260978
(2R)-N-butyl-N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-2-phenylbutanamide (PubChem CID 7260978) has the molecular formula C26H31FN2O and a molecular weight of 406.55 g/mol. Its IUPAC name is (2R)-N-butyl-N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-2-phenylbutanamide.
| Compound Name | (2R)-N-butyl-N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-2-phenylbutanamide |
|---|---|
| PubChem CID | 7260978 |
| Molecular Formula | C26H31FN2O |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | (2R)-N-butyl-N-[[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl]-2-phenylbutanamide |
| SMILES | CCCCN(Cc1cccn1Cc1cccc(F)c1)C(=O)[C@H](CC)c1ccccc1 |
| InChI | InChI=1S/C26H31FN2O/c1-3-5-16-29(26(30)25(4-2)22-12-7-6-8-13-22)20-24-15-10-17-28(24)19-21-11-9-14-23(27)18-21/h6-15,17-18,25H,3-5,16,19-20H2,1-2H3/t25-/m1/s1 |
| InChIKey | WJBZIFVRPWVTBI-RUZDIDTESA-N |
| XLogP | 6.00 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |