C24H24F3N3O2 — CID 4202857
3-(4-methoxyphenyl)-1-prop-2-enyl-1-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]urea (PubChem CID 4202857) has the molecular formula C24H24F3N3O2 and a molecular weight of 443.47 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1-prop-2-enyl-1-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]urea.
| Compound Name | 3-(4-methoxyphenyl)-1-prop-2-enyl-1-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]urea |
|---|---|
| PubChem CID | 4202857 |
| Molecular Formula | C24H24F3N3O2 |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 3-(4-methoxyphenyl)-1-prop-2-enyl-1-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]urea |
| SMILES | C=CCN(Cc1cccn1Cc1cccc(C(F)(F)F)c1)C(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C24H24F3N3O2/c1-3-13-30(23(31)28-20-9-11-22(32-2)12-10-20)17-21-8-5-14-29(21)16-18-6-4-7-19(15-18)24(25,26)27/h3-12,14-15H,1,13,16-17H2,2H3,(H,28,31) |
| InChIKey | APQDLEVWZTXUDY-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|