C21H19F3N2O2 — CID 42763489
N-prop-2-enyl-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]furan-2-carboxamide (PubChem CID 42763489) has the molecular formula C21H19F3N2O2 and a molecular weight of 388.39 g/mol. Its IUPAC name is N-prop-2-enyl-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]furan-2-carboxamide.
| Compound Name | N-prop-2-enyl-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 42763489 |
| Molecular Formula | C21H19F3N2O2 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | N-prop-2-enyl-N-[[1-[[3-(trifluoromethyl)phenyl]methyl]pyrrol-2-yl]methyl]furan-2-carboxamide |
| SMILES | C=CCN(Cc1cccn1Cc1cccc(C(F)(F)F)c1)C(=O)c1ccco1 |
| InChI | InChI=1S/C21H19F3N2O2/c1-2-10-26(20(27)19-9-5-12-28-19)15-18-8-4-11-25(18)14-16-6-3-7-17(13-16)21(22,23)24/h2-9,11-13H,1,10,14-15H2 |
| InChIKey | PEKDPAITGYCOFI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 38.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|